4-amino-5-chloro-10h-acridin-9-one structure
|
Common Name | 4-amino-5-chloro-10h-acridin-9-one | ||
|---|---|---|---|---|
| CAS Number | 893612-47-0 | Molecular Weight | 244.67600 | |
| Density | 1.415g/cm3 | Boiling Point | 452.6ºC at 760 mmHg | |
| Molecular Formula | C13H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.5ºC | |
| Name | 4-amino-5-chloro-10h-acridin-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 452.6ºC at 760 mmHg |
| Molecular Formula | C13H9ClN2O |
| Molecular Weight | 244.67600 |
| Flash Point | 227.5ºC |
| Exact Mass | 244.04000 |
| PSA | 58.88000 |
| LogP | 3.49810 |
| Index of Refraction | 1.694 |
| InChIKey | DBLGQYKZJAGWQA-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c(=O)c3cccc(Cl)c3[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GL-0645 |
| 9(10H)-Acridinone,4-amino-5-chloro |
| 4-amino-5-chloro-9,10-dihydroacridin-9-one |