2’-hydroxy Cocaine structure
|
Common Name | 2’-hydroxy Cocaine | ||
|---|---|---|---|---|
| CAS Number | 89339-17-3 | Molecular Weight | 319.35 | |
| Density | 1.30±0.1 g/cm3(Predicted) | Boiling Point | 416.2±45.0 °C(Predicted) | |
| Molecular Formula | C17H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2’-hydroxy Cocaine2’-hydroxy Cocaine is an analytical reference material that is structurally categorized as a tropane. |
| Name | 2hydroxy Cocaine |
|---|
| Density | 1.30±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 416.2±45.0 °C(Predicted) |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.35 |
| InChIKey | PEISRHQJLATJPJ-MMMKDXCPSA-N |
| SMILES | COC(=O)C1C(OC(=O)c2ccccc2O)CC2CCC1N2C |
| Storage condition | -20°C |
| RIDADR | UN 1648 3 / PGII |
|---|