2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]-1,3-thiazol-4-one structure
|
Common Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]-1,3-thiazol-4-one | ||
|---|---|---|---|---|
| CAS Number | 89335-24-0 | Molecular Weight | 294.71700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7ClN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]-1,3-thiazol-4-one |
|---|
| Molecular Formula | C11H7ClN4O2S |
|---|---|
| Molecular Weight | 294.71700 |
| Exact Mass | 293.99800 |
| PSA | 108.91000 |
| LogP | 1.28880 |
| InChIKey | LALPDCFKZHFAPN-UHFFFAOYSA-N |
| SMILES | O=C1CSC(=Nc2nnc(-c3ccccc3Cl)o2)N1 |
|
~%
2-[[5-(2-chloro... CAS#:89335-24-0 |
| Literature: Naik; Meher; Nayak Journal of the Indian Chemical Society, 1983 , vol. 60, # 7 p. 674 - 678 |
|
~%
2-[[5-(2-chloro... CAS#:89335-24-0 |
| Literature: Naik; Meher; Nayak Journal of the Indian Chemical Society, 1983 , vol. 60, # 7 p. 674 - 678 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |