[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]thiourea structure
|
Common Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 89335-12-6 | Molecular Weight | 254.69600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClN4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]thiourea |
|---|
| Molecular Formula | C9H7ClN4OS |
|---|---|
| Molecular Weight | 254.69600 |
| Exact Mass | 254.00300 |
| PSA | 116.83000 |
| LogP | 2.18810 |
| InChIKey | BZQPFGAJMNOFKA-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1nnc(-c2ccc(Cl)cc2)o1 |
|
~%
[5-(4-chlorophe... CAS#:89335-12-6 |
| Literature: Chauhan, Deepa; Chauhan; Singh; Bajpai; Joshi Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 1 p. 215 - 218 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |