1-[(4-bromophenyl)methyl]quinolin-1-ium-3-carbonitrile structure
|
Common Name | 1-[(4-bromophenyl)methyl]quinolin-1-ium-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 89321-41-5 | Molecular Weight | 324.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12BrN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(4-bromophenyl)methyl]quinolin-1-ium-3-carbonitrile |
|---|
| Molecular Formula | C17H12BrN2+ |
|---|---|
| Molecular Weight | 324.19500 |
| Exact Mass | 323.01800 |
| PSA | 27.67000 |
| LogP | 3.80978 |
| InChIKey | XUTCKSBUGUNBGO-UHFFFAOYSA-N |
| SMILES | N#Cc1cc2ccccc2[n+](Cc2ccc(Br)cc2)c1 |
|
~%
1-[(4-bromophen... CAS#:89321-41-5 |
| Literature: Kreevoy, Maurice M.; Lee, In-Sook Han Journal of the American Chemical Society, 1984 , vol. 106, # 9 p. 2550 - 2553 |