4-Pyridinamine,3-nitro-, 1-oxide structure
|
Common Name | 4-Pyridinamine,3-nitro-, 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 89317-24-8 | Molecular Weight | 155.11100 | |
| Density | 1.63g/cm3 | Boiling Point | 266.1ºC at 760 mmHg | |
| Molecular Formula | C5H5N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.7ºC | |
| Name | 1-hydroxy-3-nitropyridin-4-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 266.1ºC at 760 mmHg |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11100 |
| Flash Point | 114.7ºC |
| Exact Mass | 155.03300 |
| PSA | 97.30000 |
| LogP | 1.70990 |
| Index of Refraction | 1.671 |
| InChIKey | UZNIRGLKZORSOU-UHFFFAOYSA-N |
| SMILES | N=c1ccn(O)cc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-nitro-1-oxy-pyridin-4-ylamine |
| 3-Nitro-4-amino-pyridin-1-oxid |
| (4e)-4-imino-3-nitropyridin-1(4h)-ol |
| 4-Pyridinamine,3-nitro-,1-oxide |