3-Oxalomalic acid
Modify Date: 2025-08-20 15:01:43
3-Oxalomalic acid structure
|
Common Name | 3-Oxalomalic acid | ||
|---|---|---|---|---|
| CAS Number | 89304-26-7 | Molecular Weight | 206.107 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 439.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Na3O8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 233.9±25.2 °C | |
Use of 3-Oxalomalic acidOxalomalic Acid sodium salt inhibits aconitase and NADP-dependent isocitrate dehydrogenase. |
| Name | Oxalomalic acid trisodium salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.8±45.0 °C at 760 mmHg |
| Molecular Formula | C6H3Na3O8 |
| Molecular Weight | 206.107 |
| Flash Point | 233.9±25.2 °C |
| Exact Mass | 206.006271 |
| PSA | 157.69000 |
| LogP | -1.07 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | YILAUJBAPQXZGM-UHFFFAOYSA-K |
| SMILES | O=C([O-])C(=O)C(C(=O)[O-])C(O)C(=O)[O-] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| oxalomalic acid trisodium |
| 3-Oxalomalic acid |
| 3-Carboxy-3-deoxypent-2-ulosaric acid |
| 2-Pentulosaric acid, 3-carboxy-3-deoxy- |
| Oxalomalic Acid (sodium salt) |
| 1,2,3-Propanetricarboxylic acid, 1-hydroxy-3-oxo- |