2-[4-(benzenesulfonylmethyl)-3-nitrophenyl]-1,3-dioxolane
Modify Date: 2025-09-23 14:53:57
![2-[4-(benzenesulfonylmethyl)-3-nitrophenyl]-1,3-dioxolane Structure](https://image.chemsrc.com/caspic/062/89303-50-4.png)
2-[4-(benzenesulfonylmethyl)-3-nitrophenyl]-1,3-dioxolane structure
|
Common Name | 2-[4-(benzenesulfonylmethyl)-3-nitrophenyl]-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 89303-50-4 | Molecular Weight | 349.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(benzenesulfonylmethyl)-3-nitrophenyl]-1,3-dioxolane |
|---|
| Molecular Formula | C16H15NO6S |
|---|---|
| Molecular Weight | 349.35800 |
| Exact Mass | 349.06200 |
| PSA | 106.80000 |
| LogP | 4.21810 |
| InChIKey | CBMBZUUHKGVHCL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C2OCCO2)ccc1CS(=O)(=O)c1ccccc1 |
|
~%
2-[4-(benzenesu... CAS#:89303-50-4 |
| Literature: Vazquez, M. Eugenio; Blanco, Juan B.; Imperiali Journal of the American Chemical Society, 2005 , vol. 127, # 4 p. 1300 - 1306 |
|
~%
2-[4-(benzenesu... CAS#:89303-50-4 |
| Literature: Makosza, Mieczyslaw; Golinski, Jerzy; Baran, Janusz Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1488 - 1494 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |