ethyl 4-(4-methylbenzoyl)piperazine-1-carboxylate structure
|
Common Name | ethyl 4-(4-methylbenzoyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 89292-73-9 | Molecular Weight | 276.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(4-methylbenzoyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20N2O3 |
|---|---|
| Molecular Weight | 276.33100 |
| Exact Mass | 276.14700 |
| PSA | 49.85000 |
| LogP | 1.78510 |
| InChIKey | ISJOIACNCFZKQI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 |
|
~51%
ethyl 4-(4-meth... CAS#:89292-73-9 |
| Literature: Abbavaram, Babul Reddy A.; Reddyvari, Hymavathi R.V. Journal of the Korean Chemical Society, 2013 , vol. 57, # 6 p. 731 - 737 |
|
~%
ethyl 4-(4-meth... CAS#:89292-73-9 |
| Literature: American Cyanamid Company Patent: US4421753 A1, 1983 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-p-toluoyl-1-piperazinecarboxylic acid,ethyl ester |