7-bromoquinoline-2,3-dicarboxylic acid
Modify Date: 2025-09-16 20:44:24
7-bromoquinoline-2,3-dicarboxylic acid structure
|
Common Name | 7-bromoquinoline-2,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 892874-38-3 | Molecular Weight | 296.07400 | |
| Density | 1.873g/cm3 | Boiling Point | 473.1ºC at 760 mmHg | |
| Molecular Formula | C11H6BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.9ºC | |
| Name | 7-bromoquinoline-2,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.873g/cm3 |
|---|---|
| Boiling Point | 473.1ºC at 760 mmHg |
| Molecular Formula | C11H6BrNO4 |
| Molecular Weight | 296.07400 |
| Flash Point | 239.9ºC |
| Exact Mass | 294.94800 |
| PSA | 87.49000 |
| LogP | 2.39370 |
| Index of Refraction | 1.74 |
| InChIKey | VAXBHJZBCSBXTC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2ccc(Br)cc2nc1C(=O)O |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| qu046 |