6-Methoxycarbonyl-2,4,5-trichloropyrimidine structure
|
Common Name | 6-Methoxycarbonyl-2,4,5-trichloropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 89284-85-5 | Molecular Weight | 241.459 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 342.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.0±26.5 °C | |
| Name | Methyl 2,5,6-trichloropyrimidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.7±37.0 °C at 760 mmHg |
| Molecular Formula | C6H3Cl3N2O2 |
| Molecular Weight | 241.459 |
| Flash Point | 161.0±26.5 °C |
| Exact Mass | 239.926010 |
| PSA | 52.08000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | TVFOOGACHSHHSX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nc(Cl)nc(Cl)c1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~81%
6-Methoxycarbon... CAS#:89284-85-5 |
| Literature: SYNGENTA LIMITED; WHITTINGHAM, William Guy; WINN, Caroline Louise; GLITHRO, Harry; ASPINALL, Mary Bernadette; SCREPANTI, Claudio Patent: WO2010/125332 A1, 2010 ; Location in patent: Page/Page column 19 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Pyrimidinecarboxylic acid, 2,5,6-trichloro-, methyl ester |
| methyl 2,5,6-trichloropyrimidine-4-carboxylate |
| Methyl 2,5,6-trichloro-4-pyrimidinecarboxylate |