Ethanone, 2-chloro-2,2-difluoro-1-(4-methylphenyl)- (9CI) structure
|
Common Name | Ethanone, 2-chloro-2,2-difluoro-1-(4-methylphenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 89264-09-5 | Molecular Weight | 204.60100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClF2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-2,2-difluoro-1-(4-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7ClF2O |
|---|---|
| Molecular Weight | 204.60100 |
| Exact Mass | 204.01500 |
| PSA | 17.07000 |
| LogP | 3.00930 |
| InChIKey | OZYGMZLILGYXLF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(F)(F)Cl)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Ethanone,2-chloro-2,2-difluoro-1-(4-methylphenyl) |
| 2-CHLORO-2,2-DIFLUORO-1-(4-METHYLPHENYL)-ETHANONE |