4-chloro-N-(cyanomethyl)-N-methylbenzamide structure
|
Common Name | 4-chloro-N-(cyanomethyl)-N-methylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 89244-13-3 | Molecular Weight | 208.64400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-(cyanomethyl)-N-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9ClN2O |
|---|---|
| Molecular Weight | 208.64400 |
| Exact Mass | 208.04000 |
| PSA | 44.10000 |
| LogP | 1.93558 |
| InChIKey | ZBWJPHPSHFYUCU-UHFFFAOYSA-N |
| SMILES | CN(CC#N)C(=O)c1ccc(Cl)cc1 |
|
~82%
4-chloro-N-(cya... CAS#:89244-13-3 |
| Literature: Takahashi, Kazumasa; Masuda, Takumi; Ogura, Katsuyuki; Iida, Hirotada Synthesis, 1983 , # 12 p. 1043 - 1045 |
|
~85%
4-chloro-N-(cya... CAS#:89244-13-3 |
| Literature: Zoete, Vincent; Bailly, Fabrice; Catteau, Jean-Pierre; Bernier, Jean-Luc Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 20 p. 2983 - 2988 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzamide,4-chloro-N-(cyanomethyl)-N-methyl |