4,6-dimethyl-2-(4-nitrophenyl)-1,3-dioxane structure
|
Common Name | 4,6-dimethyl-2-(4-nitrophenyl)-1,3-dioxane | ||
|---|---|---|---|---|
| CAS Number | 89238-89-1 | Molecular Weight | 237.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-dimethyl-2-(4-nitrophenyl)-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO4 |
|---|---|
| Molecular Weight | 237.25200 |
| Exact Mass | 237.10000 |
| PSA | 64.28000 |
| LogP | 3.33050 |
| InChIKey | YLMGXPIELVOYDG-UHFFFAOYSA-N |
| SMILES | CC1CC(C)OC(c2ccc([N+](=O)[O-])cc2)O1 |
|
~42%
4,6-dimethyl-2-... CAS#:89238-89-1 |
| Literature: Denmark, Scott E.; Almstead, Neil G. Journal of the American Chemical Society, 1991 , vol. 113, # 21 p. 8089 - 8110 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-Dioxane,4,6-dimethyl-2-(4-nitrophenyl) |