4,6-dichlorobenzene-1,3-disulfonic acid structure
|
Common Name | 4,6-dichlorobenzene-1,3-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 89222-84-4 | Molecular Weight | 307.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-dichlorobenzene-1,3-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4Cl2O6S2 |
|---|---|
| Molecular Weight | 307.12800 |
| Exact Mass | 305.88300 |
| PSA | 125.50000 |
| LogP | 3.64840 |
| InChIKey | FIARTZUAZVFCHA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c(Cl)cc1Cl |
|
~%
4,6-dichloroben... CAS#:89222-84-4 |
| Literature: Davies; Poole Journal of the Chemical Society, 1927 , p. 1123 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1,3-Benzenedisulfonic acid,4,6-dichloro |
| 4,6-Dichlor-benzol-1,3-disulfonsaeure |
| 4,6-dichloro-benzene-1,3-disulfonic acid |