4-(6-diethoxyphosphorylhexoxy)phenol
Modify Date: 2025-11-13 20:23:32
4-(6-diethoxyphosphorylhexoxy)phenol structure
|
Common Name | 4-(6-diethoxyphosphorylhexoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 89210-98-0 | Molecular Weight | 330.35600 | |
| Density | 1.111g/cm3 | Boiling Point | 472.5ºC at 760 mmHg | |
| Molecular Formula | C16H27O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.6ºC | |
| Name | 4-(6-diethoxyphosphorylhexoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 472.5ºC at 760 mmHg |
| Molecular Formula | C16H27O5P |
| Molecular Weight | 330.35600 |
| Flash Point | 239.6ºC |
| Exact Mass | 330.16000 |
| PSA | 74.80000 |
| LogP | 4.59750 |
| Index of Refraction | 1.496 |
| InChIKey | GOVRUDUDKKLLTQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCOc1ccc(O)cc1)OCC |
|
~73%
4-(6-diethoxyph... CAS#:89210-98-0 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
|
~%
4-(6-diethoxyph... CAS#:89210-98-0 |
| Literature: Diana, G. D.; Zalay, E. S.; Salvador, U. J.; Pancic, F.; Steinberg, B. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 691 - 694 |
![[4-(6-diethoxyphosphorylhexoxy)phenyl] acetate structure](https://image.chemsrc.com/caspic/351/89210-97-9.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphonic acid,[6-(4-hydroxyphenoxy)hexyl]-,diethyl ester |
| diethyl [2-(4-acetoxyphenoxy)ethyl]phosphonate |