acetic acid,2,5-bis(phenylsulfanyl)benzene-1,4-diol
Modify Date: 2025-08-28 22:19:23
acetic acid,2,5-bis(phenylsulfanyl)benzene-1,4-diol structure
|
Common Name | acetic acid,2,5-bis(phenylsulfanyl)benzene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 89202-65-3 | Molecular Weight | 446.53600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,2,5-bis(phenylsulfanyl)benzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H22O6S2 |
|---|---|
| Molecular Weight | 446.53600 |
| Exact Mass | 446.08600 |
| PSA | 165.66000 |
| LogP | 5.58200 |
| InChIKey | GFFGEVPKZZQPJL-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.Oc1cc(Sc2ccccc2)c(O)cc1Sc1ccccc1 |
|
~%
acetic acid,2,5... CAS#:89202-65-3 |
| Literature: Blackhall; Thomson Journal of the Chemical Society, 1953 , p. 1138,1141 |
|
~%
acetic acid,2,5... CAS#:89202-65-3 |
| Literature: Posner Justus Liebigs Annalen der Chemie, 1904 , vol. 336, p. 88,117 |
| 1,4-Diacetoxy-2,5-bis-phenylmercapto-benzol |
| 2,5-Diacetoxy-1,4-diphenylmercapto-benzol |
| 1,4-diacetoxy-2,5-bis-phenylsulfanyl-benzene |
| 1,4-Benzenediol,2,5-bis(phenylthio)-,diacetate |
| (2,5-Diphenylmercapto-p-phenylen)-diacetat |
| 1.4-Diacetoxy-2.5-bis-phenylthio-benzol |