5-Boc-amino-pyrazine-2-carboxylic acid structure
|
Common Name | 5-Boc-amino-pyrazine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 891782-63-1 | Molecular Weight | 239.228 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 363.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.5±27.9 °C | |
| Name | 5-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.2±42.0 °C at 760 mmHg |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.228 |
| Flash Point | 173.5±27.9 °C |
| Exact Mass | 239.090607 |
| PSA | 101.41000 |
| LogP | 0.52 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | MOLNWRVQKCBISZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(C(=O)O)cn1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyrazinecarboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 5-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-pyrazinecarboxylic acid |
| 5-BOC-AMINO-PYRAZINE-2-CARBOXYLIC ACID |
| 5-(tert-butoxycarbonylamino)pyrazine-2-carboxylic acid |
| QC-273 |