2,3-di(propan-2-yloxy)naphthalene-1,4-dione structure
|
Common Name | 2,3-di(propan-2-yloxy)naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 89131-32-8 | Molecular Weight | 274.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-di(propan-2-yloxy)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18O4 |
|---|---|
| Molecular Weight | 274.31200 |
| Exact Mass | 274.12100 |
| PSA | 52.60000 |
| LogP | 3.12720 |
| InChIKey | GFCBQNWHJNGVSP-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(OC(C)C)C(=O)c2ccccc2C1=O |
|
~%
2,3-di(propan-2... CAS#:89131-32-8 |
| Literature: Energy Conversion Devices, Inc. Patent: US4532078 A1, 1985 ; |
|
~%
2,3-di(propan-2... CAS#:89131-32-8 |
| Literature: Flaten, Vivian M.; Santos, Jose G.; Valderrama, Jaime A. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 451 - 456 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-Naphthalenedione,2,3-bis(1-methylethoxy) |
| 2,3-di-isopropoxy-1,4-naphthoquinone |