1,1':4',1''-Terphenyl-3,4'',5-triol
Modify Date: 2025-08-25 19:42:31
1,1':4',1''-Terphenyl-3,4'',5-triol structure
|
Common Name | 1,1':4',1''-Terphenyl-3,4'',5-triol | ||
|---|---|---|---|---|
| CAS Number | 890854-82-7 | Molecular Weight | 278.302 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 543.6±29.0 °C at 760 mmHg | |
| Molecular Formula | C18H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7±18.9 °C | |
Use of 1,1':4',1''-Terphenyl-3,4'',5-triolCAY10503 is a proapoptotic, antiproliferative compound that is able to arrest cell cycle progression in the G0-G1 phase. |
| Name | cay10503 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.6±29.0 °C at 760 mmHg |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.302 |
| Flash Point | 263.7±18.9 °C |
| Exact Mass | 278.094299 |
| PSA | 60.69000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | DADMQAUVBPTTDT-UHFFFAOYSA-N |
| SMILES | Oc1ccc(-c2ccc(-c3cc(O)cc(O)c3)cc2)cc1 |
| 1,1':4',1''-Terphenyl-3,4'',5-triol |
| [1,1':4',1''-Terphenyl]-3,4'',5-triol |