4(3H)-Pyrimidinone, 3-(1,1'-biphenyl)-2-yl-2-(methylthio)- structure
|
Common Name | 4(3H)-Pyrimidinone, 3-(1,1'-biphenyl)-2-yl-2-(methylthio)- | ||
|---|---|---|---|---|
| CAS Number | 89069-35-2 | Molecular Weight | 294.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylsulfanyl-3-(2-phenylphenyl)pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14N2OS |
|---|---|
| Molecular Weight | 294.37100 |
| Exact Mass | 294.08300 |
| PSA | 60.19000 |
| LogP | 3.62140 |
| InChIKey | NKWLRMQSIJTFMJ-UHFFFAOYSA-N |
| SMILES | CSc1nccc(=O)n1-c1ccccc1-c1ccccc1 |
| HS Code | 2933599090 |
|---|
|
~40%
4(3H)-Pyrimidin... CAS#:89069-35-2 |
| Literature: Gupta, K. A.; Saxena, Anil K.; Jain, Padam C.; Dua, P. R.; Prasad, C. R.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 789 - 794 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(1,1'-Biphenyl)-2-yl-2-(methylthio)-4(3H)-pyrimidinone |
| 4(3H)-Pyrimidinone,3-[1,1'-biphenyl]-2-yl-2-(methylthio) |
| 3-(2-biphenyl)-2-methylthio-4(3H)-pyrimidinone |