(3-METHYLIMIDAZO[2,1-B][1,3]THIAZOL-6-YL)-METHYLAMINE structure
|
Common Name | (3-METHYLIMIDAZO[2,1-B][1,3]THIAZOL-6-YL)-METHYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 890596-67-5 | Molecular Weight | 210.23000 | |
| Density | 1.23g/cm3 | Boiling Point | 389.7ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Name | 3-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760 mmHg |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23000 |
| Flash Point | 189.5ºC |
| Exact Mass | 210.10000 |
| PSA | 72.19000 |
| LogP | 1.17720 |
| Index of Refraction | 1.562 |
| InChIKey | XQLFKVOEQTWWDK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(C)nn(CCC(=O)O)c1C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |