2,2-dimethyl-5-[(2-methyl-1-piperidyl)methylidene]-1,3-dioxane-4,6-dione structure
|
Common Name | 2,2-dimethyl-5-[(2-methyl-1-piperidyl)methylidene]-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 89044-58-6 | Molecular Weight | 253.29400 | |
| Density | 1.202g/cm3 | Boiling Point | 426.7ºC at 760 mmHg | |
| Molecular Formula | C13H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.8ºC | |
| Name | 2,2-dimethyl-5-[(2-methylpiperidin-1-yl)methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 426.7ºC at 760 mmHg |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.29400 |
| Flash Point | 211.8ºC |
| Exact Mass | 253.13100 |
| PSA | 55.84000 |
| LogP | 1.51870 |
| Index of Refraction | 1.546 |
| InChIKey | BGSZTMCDOQEVQH-UHFFFAOYSA-N |
| SMILES | CC1CCCCN1C=C1C(=O)OC(C)(C)OC1=O |
|
~87%
2,2-dimethyl-5-... CAS#:89044-58-6 |
| Literature: McNab, Hamish; Monahan, Lilian C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 863 - 868 |
| 2,2-dimethyl-5-(2-methylpiperidin-1-yl)methylene-1,3-dioxane-4,6-dione |
| 2,2-dimethyl-5-<1-(2-methylpiperidino)methylene>-1,3-dioxane-4,6-dione |