5-[(dicyclohexylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione
Modify Date: 2025-09-21 09:30:09
![5-[(dicyclohexylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione Structure](https://image.chemsrc.com/caspic/160/89044-57-5.png)
5-[(dicyclohexylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione structure
|
Common Name | 5-[(dicyclohexylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 89044-57-5 | Molecular Weight | 335.43800 | |
| Density | 1.14g/cm3 | Boiling Point | 509.8ºC at 760 mmHg | |
| Molecular Formula | C19H29NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.1ºC | |
| Name | 5-[(dicyclohexylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 509.8ºC at 760 mmHg |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.43800 |
| Flash Point | 262.1ºC |
| Exact Mass | 335.21000 |
| PSA | 55.84000 |
| LogP | 3.67380 |
| Index of Refraction | 1.536 |
| InChIKey | NOEUNVQVFGHTFB-UHFFFAOYSA-N |
| SMILES | CC1(C)OC(=O)C(=CN(C2CCCCC2)C2CCCCC2)C(=O)O1 |
|
~96%
5-[(dicyclohexy... CAS#:89044-57-5 |
| Literature: Hickson, Clare L.; Keith, Eileen M.; Martin, Jane C.; McNab, Hamish; Monahan, Lilian C.; Walkinshaw, Malcolm D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 1465 - 1470 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![1-cyclohexyl-1-azaspiro[4.5]dec-2-en-4-one structure](https://image.chemsrc.com/caspic/084/89044-59-7.png)
CAS#:89044-59-7| 5-(2,2-dicyclohexyl-2-azaethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |