XP-59
Modify Date: 2025-08-24 19:46:01
XP-59 structure
|
Common Name | XP-59 | ||
|---|---|---|---|---|
| CAS Number | 890402-73-0 | Molecular Weight | 282.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of XP-59XP-59 is a potent inhibitor of the SARS-CoV Mpro, with a Ki of 0.1 μM[1]. |
| Name | XP-59 |
|---|
| Description | XP-59 is a potent inhibitor of the SARS-CoV Mpro, with a Ki of 0.1 μM[1]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 0.1 nM (SARS-CoV Mpro)[1]. |
| In Vitro | The SARS-CoV main proteinase (Mpro) plays a central role in the formation of the viral replicase/transcriptase complex and is thus an ideal target for the development of suitable drugs[1]. |
| References |
| Molecular Formula | C15H14N4O2 |
|---|---|
| Molecular Weight | 282.30 |
| InChIKey | UOITWBIZHQLMTH-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)On2nnc3ccccc32)cc1 |