(3-chlorophenyl)-(3,5-diphenyl-1,2-oxazol-4-yl)diazene
Modify Date: 2025-09-09 16:31:21
(3-chlorophenyl)-(3,5-diphenyl-1,2-oxazol-4-yl)diazene structure
|
Common Name | (3-chlorophenyl)-(3,5-diphenyl-1,2-oxazol-4-yl)diazene | ||
|---|---|---|---|---|
| CAS Number | 89013-32-1 | Molecular Weight | 359.80800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-chlorophenyl)-(3,5-diphenyl-1,2-oxazol-4-yl)diazene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H14ClN3O |
|---|---|
| Molecular Weight | 359.80800 |
| Exact Mass | 359.08300 |
| PSA | 50.75000 |
| LogP | 7.07740 |
| InChIKey | ZRXZWNSXALCGRO-UHFFFAOYSA-N |
| SMILES | Clc1cccc(N=Nc2c(-c3ccccc3)noc2-c2ccccc2)c1 |
|
~%
(3-chlorophenyl... CAS#:89013-32-1 |
| Literature: Garg,H.G. Journal of the Indian Chemical Society, 1963 , vol. 40, p. 135 - 136 |
![diphenyl-propanetrione 2-[(3-chloro-phenyl)-hydrazone] structure](https://image.chemsrc.com/caspic/057/84037-20-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-<3-Chlor-phenylazo>-3,5-phenyl-isoxazol |
| Isoxazole,4-[(3-chlorophenyl)azo]-3,5-diphenyl |
| 4-(3-chloro-phenylazo)-3,5-diphenyl-isoxazole |