4-(3-ACETOXYPHENYL)-2-CHLORO-1-BUTENE structure
|
Common Name | 4-(3-ACETOXYPHENYL)-2-CHLORO-1-BUTENE | ||
|---|---|---|---|---|
| CAS Number | 890097-80-0 | Molecular Weight | 224.68300 | |
| Density | 1.128g/cm3 | Boiling Point | 286.5ºC at 760 mmHg | |
| Molecular Formula | C12H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133ºC | |
| Name | [3-(3-chlorobut-3-enyl)phenyl] acetate |
|---|
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 286.5ºC at 760 mmHg |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.68300 |
| Flash Point | 133ºC |
| Exact Mass | 224.06000 |
| PSA | 26.30000 |
| LogP | 3.29700 |
| Index of Refraction | 1.522 |
| InChIKey | OTVLKPREPCFLQL-UHFFFAOYSA-N |
| SMILES | C=C(Cl)CCc1cccc(OC(C)=O)c1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |