6-methyl-2,3-diphenyl-7,8-dihydroimidazo[1,2-b]pyridazine
Modify Date: 2025-09-10 17:16:58
![6-methyl-2,3-diphenyl-7,8-dihydroimidazo[1,2-b]pyridazine Structure](https://image.chemsrc.com/caspic/302/89004-11-5.png)
6-methyl-2,3-diphenyl-7,8-dihydroimidazo[1,2-b]pyridazine structure
|
Common Name | 6-methyl-2,3-diphenyl-7,8-dihydroimidazo[1,2-b]pyridazine | ||
|---|---|---|---|---|
| CAS Number | 89004-11-5 | Molecular Weight | 287.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-2,3-diphenyl-7,8-dihydroimidazo[1,2-b]pyridazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H17N3 |
|---|---|
| Molecular Weight | 287.35800 |
| Exact Mass | 287.14200 |
| PSA | 30.18000 |
| LogP | 3.82290 |
| InChIKey | GZTMIHQPIIGIJV-UHFFFAOYSA-N |
| SMILES | CC1=Nn2c(nc(-c3ccccc3)c2-c2ccccc2)CC1 |
|
~81%
6-methyl-2,3-di... CAS#:89004-11-5 |
| Literature: Sasaki, Tadashi; Ohno, Masatomi; Ito, Eikoh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 3027 - 3030 |
|
~%
6-methyl-2,3-di... CAS#:89004-11-5 |
| Literature: Sasaki, Tadashi; Ohno, Masatomi; Ito, Eikoh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 3027 - 3030 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![6-methyl-2,3-diphenyl-5,6,7,8-tetrahydroimidazo[1,2-b]pyridazine structure](https://image.chemsrc.com/caspic/226/89004-13-7.png)
CAS#:89004-13-7| 6-methyl-2,3-diphenyl-7,8-dihydroimidazo<1,2-b>pyridazine |
| Imidazo[1,2-b]pyridazine,7,8-dihydro-6-methyl-2,3-diphenyl |