5-(Chlorosulfonyl)-2-methylbenzoic acid structure
|
Common Name | 5-(Chlorosulfonyl)-2-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 89001-57-0 | Molecular Weight | 234.657 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 398.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H7ClO4S | Melting Point | 152-154ºC | |
| MSDS | N/A | Flash Point | 194.9±25.9 °C | |
| Name | 5-chlorosulfonyl-2-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.7±35.0 °C at 760 mmHg |
| Melting Point | 152-154ºC |
| Molecular Formula | C8H7ClO4S |
| Molecular Weight | 234.657 |
| Flash Point | 194.9±25.9 °C |
| Exact Mass | 233.975357 |
| PSA | 79.82000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | FMWIOAWRARBKDQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Cl)cc1C(=O)O |
| HS Code | 2916399090 |
|---|
|
~91%
5-(Chlorosulfon... CAS#:89001-57-0 |
| Literature: Yang, Yung-Lin; Rajagopal, Basker; Liang, Chien-Fu; Chen, Chun-Chi; Lai, Hsiu-Ping; Chou, Chih-Hung; Lee, Yen-Pin; Yang, Yen-Ling; Zeng, Jing-Wen; Ou, Chun-Lin; Lin, Po-Chiao Tetrahedron, 2013 , vol. 69, # 12 p. 2640 - 2646 |
|
~80%
5-(Chlorosulfon... CAS#:89001-57-0 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2005/92845 A1, 2005 ; Location in patent: Page/Page column 136 ; WO 2005/092845 A1 |
|
~%
5-(Chlorosulfon... CAS#:89001-57-0 |
| Literature: US2237974 , ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 5-(chlorosulfonyl)-2-methyl- |
| 2-methyl-5-chlorosulfonyl benzoic acid |
| WSGR D1 CVQ |
| Benzoic acid,5-(chlorosulfonyl)-2-methyl |
| 2-Methyl-5-chlorsulfonyl-benzoesaeure |
| 5-(Chlorosulfonyl)-2-methylbenzenecarboxylic acid |
| 5-Chlorosulfonyl-2-methylbenzoic acid |
| 5-Chlorsulfonyl-2-methyl-benzoesaeure |
| 5-(Chlorosulfonyl)-2-Methyl-Benzoic Acid |
| 5-(Chlorosulphonyl)-2-methylbenzoic acid |
| 5-(Chlorosulfonyl)-2-methylbenzoic acid |