1-bromo-4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene structure
|
Common Name | 1-bromo-4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene | ||
|---|---|---|---|---|
| CAS Number | 88964-95-8 | Molecular Weight | 462.02200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H8Br2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H8Br2F6 |
|---|---|
| Molecular Weight | 462.02200 |
| Exact Mass | 459.89000 |
| LogP | 6.62230 |
| InChIKey | IDGRJZAJJZGTJZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(c1ccc(Br)cc1)(c1ccc(Br)cc1)C(F)(F)F |
|
~%
1-bromo-4-[2-(4... CAS#:88964-95-8 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US4935479 A1, 1990 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2-bis(4-bromophenyl)hexafluoropropane |
| Benzene,1,1'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[4-bromo |