3-(2-amino-4-nitrophenoxy)propane-1,2-diol
Modify Date: 2025-08-25 16:05:12
3-(2-amino-4-nitrophenoxy)propane-1,2-diol structure
|
Common Name | 3-(2-amino-4-nitrophenoxy)propane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 88964-89-0 | Molecular Weight | 228.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-amino-4-nitrophenoxy)propane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12N2O5 |
|---|---|
| Molecular Weight | 228.20200 |
| Exact Mass | 228.07500 |
| PSA | 121.53000 |
| LogP | 1.01340 |
| InChIKey | WXNWGESLINOGIE-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])ccc1OCC(O)CO |
|
~0%
3-(2-amino-4-ni... CAS#:88964-89-0 |
| Literature: Avyyangar; Kalkote; Lugade; Nikrad; Sharma Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 10 p. 3159 - 3164 |
|
~%
3-(2-amino-4-ni... CAS#:88964-89-0 |
| Literature: Chem. Fabr. Sandoz Patent: DE479831 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 451 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-(2-amino-4-nitro-phenoxy)-propane-1,2-diol |
| 3-(2-Amino-4-nitro-phenoxy)-propan-1,2-diol |
| 1,2-Propanediol,3-(2-amino-4-nitrophenoxy) |
| 3-(2-amino-4-nitrophenoxy)-1,2-propanediol |