2-phenoxyethyl 4-aminobenzoate structure
|
Common Name | 2-phenoxyethyl 4-aminobenzoate | ||
|---|---|---|---|---|
| CAS Number | 88938-23-2 | Molecular Weight | 257.28400 | |
| Density | 1.199 | Boiling Point | N/A | |
| Molecular Formula | C15H15NO3 | Melting Point | 114-115ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenoxyethyl 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199 |
|---|---|
| Melting Point | 114-115ºC |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.28400 |
| Exact Mass | 257.10500 |
| PSA | 61.55000 |
| LogP | 3.08580 |
| InChIKey | XKTXFHFQGLRJKG-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)OCCOc2ccccc2)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Amino-benzoesaeure-(2-phenoxy-aethylester) |
| 4-Aminobenzoicacid2-phenoxyethylester |