2-(3,4-dichlorophenyl)-2-phenylacetic acid
Modify Date: 2025-08-25 10:48:07
2-(3,4-dichlorophenyl)-2-phenylacetic acid structure
|
Common Name | 2-(3,4-dichlorophenyl)-2-phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 88875-60-9 | Molecular Weight | 281.13400 | |
| Density | 1.373g/cm3 | Boiling Point | 403.5ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8ºC | |
| Name | 2-(3,4-dichlorophenyl)-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 403.5ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13400 |
| Flash Point | 197.8ºC |
| Exact Mass | 280.00600 |
| PSA | 37.30000 |
| LogP | 4.20990 |
| Index of Refraction | 1.616 |
| InChIKey | XHOSLHVZDULGLF-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2916399090 |
|---|
|
~82%
2-(3,4-dichloro... CAS#:88875-60-9 |
| Literature: Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 8 p. 2632 - 2638 |
|
~%
2-(3,4-dichloro... CAS#:88875-60-9 |
| Literature: Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 8 p. 2632 - 2638 |
|
~%
2-(3,4-dichloro... CAS#:88875-60-9 |
| Literature: Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 8 p. 2632 - 2638 |
|
~%
2-(3,4-dichloro... CAS#:88875-60-9 |
| Literature: Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 8 p. 2632 - 2638 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| PPD-Q04-0 |
| AR3869 |
| 3,4-dichlorodiphenylacetic acid |
| Benzeneacetic acid,3,4-dichloro-a-phenyl |
| 2-(1H-PYRAZOL-3-YL)-PIPERAZINE |