3-tert-butyl-2-(4-methoxyphenyl)benzo[e]benzimidazole structure
|
Common Name | 3-tert-butyl-2-(4-methoxyphenyl)benzo[e]benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 88842-29-9 | Molecular Weight | 330.42300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-2-(4-methoxyphenyl)benzo[e]benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H22N2O |
|---|---|
| Molecular Weight | 330.42300 |
| Exact Mass | 330.17300 |
| PSA | 27.05000 |
| LogP | 5.62010 |
| InChIKey | CFNCTJBFDABOFK-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc3c4ccccc4ccc3n2C(C)(C)C)cc1 |
|
~%
3-tert-butyl-2-... CAS#:88842-29-9 |
| Literature: Toja; Selva; Schiatti Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 610 - 616 |
|
~%
3-tert-butyl-2-... CAS#:88842-29-9 |
| Literature: Toja; Selva; Schiatti Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 610 - 616 |
|
~%
3-tert-butyl-2-... CAS#:88842-29-9 |
| Literature: Toja; Selva; Schiatti Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 610 - 616 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-tert-butyl-2-(4-methoxyphenyl)-3H-naphth[1,2-d]imidazole |
| 3H-Naphth[1,2-d]imidazole,3-(1,1-dimethylethyl)-2-(4-methoxyphenyl) |