N-[1-(4-hydroxy-3-oxo-1-cyclohepta-1,4,6-trienyl)-3-(3,4,5-trimethoxyphenyl)propyl]acetamide structure
|
Common Name | N-[1-(4-hydroxy-3-oxo-1-cyclohepta-1,4,6-trienyl)-3-(3,4,5-trimethoxyphenyl)propyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 88839-86-5 | Molecular Weight | 387.42600 | |
| Density | 1.22g/cm3 | Boiling Point | 637.8ºC at 760mmHg | |
| Molecular Formula | C21H25NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.5ºC | |
| Name | N-[1-(4-hydroxy-3-oxocyclohepta-1,4,6-trien-1-yl)-3-(3,4,5-trimethoxyphenyl)propyl]acetamide |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 637.8ºC at 760mmHg |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.42600 |
| Flash Point | 339.5ºC |
| Exact Mass | 387.16800 |
| PSA | 94.09000 |
| LogP | 2.97910 |
| InChIKey | UYCXOJZDDYJBJN-UHFFFAOYSA-N |
| SMILES | COc1cc(CCC(NC(C)=O)c2cccc(O)c(=O)c2)cc(OC)c1OC |
|
~%
N-[1-(4-hydroxy... CAS#:88839-86-5 |
| Literature: Nozoe; Takase; Kawabe; et al. Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 10 p. 3099 - 3105 |