2,4-Imidazolidinedione,5-cyclopropyl-5-phenyl- structure
|
Common Name | 2,4-Imidazolidinedione,5-cyclopropyl-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 88807-86-7 | Molecular Weight | 216.23600 | |
| Density | 1.324g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-cyclopropyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Exact Mass | 216.09000 |
| PSA | 58.20000 |
| LogP | 1.78890 |
| Index of Refraction | 1.615 |
| InChIKey | YNUMJKGENBAOAZ-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(c2ccccc2)(C2CC2)N1 |
| HS Code | 2933990090 |
|---|
|
~70%
2,4-Imidazolidi... CAS#:88807-86-7 |
| Literature: Byrtus, Hanna; Obniska, Jolanta; Czopek, Anna; Kaminski Archiv der Pharmazie, 2011 , vol. 344, # 4 p. 231 - 241 |
|
~%
2,4-Imidazolidi... CAS#:88807-86-7 |
| Literature: Henze; Gayler Journal of the American Chemical Society, 1952 , vol. 74, p. 3615 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Imidazolidinedione,5-cyclopropyl-5-phenyl |
| 5-Cyclopropyl-5-phenylhydantoin |
| 5-cyclopropyl-5-phenyl-imidazolidine-2,4-dione |
| 5-Cyclopropyl-5-phenyl-imidazolidin-2,4-dion |