(1R,2S,3R,5R)-3-(3-amino-5-methylsulfanyl-2,4,7,8,9-pentazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol structure
|
Common Name | (1R,2S,3R,5R)-3-(3-amino-5-methylsulfanyl-2,4,7,8,9-pentazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 88801-90-5 | Molecular Weight | 312.34800 | |
| Density | 2g/cm3 | Boiling Point | 687.4ºC at 760 mmHg | |
| Molecular Formula | C11H16N6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.5ºC | |
| Name | 3-(5-amino-7-methylsulfanyltriazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 2g/cm3 |
|---|---|
| Boiling Point | 687.4ºC at 760 mmHg |
| Molecular Formula | C11H16N6O3S |
| Molecular Weight | 312.34800 |
| Flash Point | 369.5ºC |
| Exact Mass | 312.10000 |
| PSA | 168.50000 |
| Index of Refraction | 1.921 |
| InChIKey | FYUBOHSLQPXGKZ-APOSLCTFSA-N |
| SMILES | CSc1nc(N)nc2c1nnn2C1CC(CO)C(O)C1O |
|
~80%
(1R,2S,3R,5R)-3... CAS#:88801-90-5 |
| Literature: Shealy; Clayton; Arnett; Shannon Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 670 - 674 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(5,7-diamino-3h-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-5-(hydroxymethyl)cyclopentane-1,2-diol |