(2,7-dichlorofluoren-9-ylidene)hydrazine structure
|
Common Name | (2,7-dichlorofluoren-9-ylidene)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 888-00-6 | Molecular Weight | 263.12200 | |
| Density | 1.49g/cm3 | Boiling Point | 434.6ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | (2,7-dichlorofluoren-9-ylidene)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 434.6ºC at 760 mmHg |
| Molecular Formula | C13H8Cl2N2 |
| Molecular Weight | 263.12200 |
| Flash Point | 216.7ºC |
| Exact Mass | 262.00600 |
| PSA | 38.38000 |
| LogP | 4.38520 |
| Index of Refraction | 1.71 |
| InChIKey | MJCKPZLVESPSQW-UHFFFAOYSA-N |
| SMILES | NN=C1c2cc(Cl)ccc2-c2ccc(Cl)cc21 |
|
~%
(2,7-dichlorofl... CAS#:888-00-6 |
| Literature: Latif,N.; Mishriky,N. Canadian Journal of Chemistry, 1964 , vol. 42, p. 2893 - 2895 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,7-Dichlor-9-hydrazono-fluoren |
| (2,7-dichloro-9h-fluoren-9-ylidene)hydrazine |