4-[bis[(5-nitrofuran-2-yl)methyl]amino]benzoic acid structure
|
Common Name | 4-[bis[(5-nitrofuran-2-yl)methyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 88796-69-4 | Molecular Weight | 387.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[bis[(5-nitrofuran-2-yl)methyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13N3O8 |
|---|---|
| Molecular Weight | 387.30000 |
| Exact Mass | 387.07000 |
| PSA | 158.46000 |
| LogP | 4.64040 |
| InChIKey | UIOAFCVTRCNRRV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N(Cc2ccc([N+](=O)[O-])o2)Cc2ccc([N+](=O)[O-])o2)cc1 |
|
~22%
4-[bis[(5-nitro... CAS#:88796-69-4 |
| Literature: Mocelo, Raul; Kovac, Jaroslav Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 9 p. 2682 - 2692 |
|
~22%
4-[bis[(5-nitro... CAS#:88796-69-4 |
| Literature: Mocelo, Raul; Kovac, Jaroslav Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 9 p. 2682 - 2692 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N'-Bis(5-Nitrofurfuryl)-4-aminobenzoic Acid |
| Benzoic acid,4-[bis[(5-nitro-2-furanyl)methyl]amino] |