3-bromo-N-(3-methylphenyl)thiophene-2-carboxamide structure
|
Common Name | 3-bromo-N-(3-methylphenyl)thiophene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 88791-36-0 | Molecular Weight | 296.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10BrNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-N-(3-methylphenyl)thiophene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10BrNOS |
|---|---|
| Molecular Weight | 296.18300 |
| Exact Mass | 294.96700 |
| PSA | 60.83000 |
| LogP | 4.45530 |
| InChIKey | NRNSYONABWWERV-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)c2sccc2Br)c1 |
|
~%
3-bromo-N-(3-me... CAS#:88791-36-0 |
| Literature: Consiglio, Giovanni; Spinelli, Domenico; Fisichella, Salvatore; Alberghina, Gaetano; Noto, Renato Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 10 p. 1559 - 1562 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Thiophenecarboxamide,3-bromo-N-(3-methylphenyl) |