5-[(2-bromo-5-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one structure
|
Common Name | 5-[(2-bromo-5-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 88791-14-4 | Molecular Weight | 330.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8BrNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(2-bromo-5-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8BrNO2S2 |
|---|---|
| Molecular Weight | 330.22100 |
| Exact Mass | 328.91800 |
| PSA | 99.21000 |
| LogP | 3.22240 |
| InChIKey | UFVOKTKHGRXOOS-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)c(C=C2SC(=S)NC2=O)c1 |
|
~70%
5-[(2-bromo-5-m... CAS#:88791-14-4 |
| Literature: Rahman, Loay K. A.; Scrowston, Richard M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2973 - 2978 |
| (5E)-5-(2-BROMO-5-METHOXYBENZYLIDENE)-2-MERCAPTO-1,3-THIAZOL-4(5H)-ONE |
| 5-(2-bromo-5-methoxybenzylidene)rhodanine |
| 4-Thiazolidinone,5-[(2-bromo-5-methoxyphenyl)methylene]-2-thioxo |