4-amino-2-chloro-5-hydroxybenzenesulfonic acid structure
|
Common Name | 4-amino-2-chloro-5-hydroxybenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 88787-40-0 | Molecular Weight | 223.63400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-2-chloro-5-hydroxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H6ClNO4S |
|---|---|
| Molecular Weight | 223.63400 |
| Exact Mass | 222.97100 |
| PSA | 109.00000 |
| LogP | 2.53650 |
| InChIKey | UQKAOPWZAUTFPK-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)O)cc1O |
|
~%
4-amino-2-chlor... CAS#:88787-40-0 |
| Literature: Bayer and Co. Patent: DE194935 ; |
|
~%
4-amino-2-chlor... CAS#:88787-40-0 |
| Literature: Bayer and Co. Patent: DE194935 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 9, p. 149 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-6-amino-phenol-sulfonsaeure-(3) |
| Benzenesulfonic acid,4-amino-2-chloro-5-hydroxy |
| 4-amino-2-chloro-5-hydroxy-benzenesulfonic acid |
| 4-Amino-2-chlor-5-hydroxy-benzolsulfonsaeure |