3-methyl-2-trimethylsilylpent-3-en-2-ol
Modify Date: 2025-10-14 18:28:31
3-methyl-2-trimethylsilylpent-3-en-2-ol structure
|
Common Name | 3-methyl-2-trimethylsilylpent-3-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 88766-80-7 | Molecular Weight | 172.34000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-2-trimethylsilylpent-3-en-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H20OSi |
|---|---|
| Molecular Weight | 172.34000 |
| Exact Mass | 172.12800 |
| PSA | 20.23000 |
| LogP | 3.00090 |
| InChIKey | QVSSCQBGILDHAM-UHFFFAOYSA-N |
| SMILES | CC=C(C)C(C)(O)[Si](C)(C)C |
|
~%
3-methyl-2-trim... CAS#:88766-80-7 |
| Literature: Kato; Mori; Oshino; Enda; Kobayashi; Kuwajima Journal of the American Chemical Society, 1984 , vol. 106, # 6 p. 1773 - 1778 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Penten-2-ol,3-methyl-2-(trimethylsilyl) |
| 3-methyl-2-(trimethylsilyl)-3-penten-2-ol |