5-ethyl-4-trimethylsilylhept-2-en-4-ol
Modify Date: 2025-10-25 17:43:26
5-ethyl-4-trimethylsilylhept-2-en-4-ol structure
|
Common Name | 5-ethyl-4-trimethylsilylhept-2-en-4-ol | ||
|---|---|---|---|---|
| CAS Number | 88766-77-2 | Molecular Weight | 214.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-4-trimethylsilylhept-2-en-4-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H26OSi |
|---|---|
| Molecular Weight | 214.42000 |
| Exact Mass | 214.17500 |
| PSA | 20.23000 |
| LogP | 4.02710 |
| InChIKey | FFPUFABFNBKEOV-UHFFFAOYSA-N |
| SMILES | CC=CC(O)(C(CC)CC)[Si](C)(C)C |
|
~73%
5-ethyl-4-trime... CAS#:88766-77-2 |
| Literature: Kato; Mori; Oshino; Enda; Kobayashi; Kuwajima Journal of the American Chemical Society, 1984 , vol. 106, # 6 p. 1773 - 1778 |
| 2-Hepten-4-ol,5-ethyl-4-(trimethylsilyl) |
| 5-ethyl-4-(trimethylsilyl)-2-hepten-4-ol |