tert-butyl-(2,4,6-tritert-butylphenyl)phosphane structure
|
Common Name | tert-butyl-(2,4,6-tritert-butylphenyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 88765-98-4 | Molecular Weight | 334.51900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H39P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H39P |
|---|---|
| Molecular Weight | 334.51900 |
| Exact Mass | 334.27900 |
| PSA | 13.59000 |
| LogP | 6.68140 |
| InChIKey | OPKQSAZPMZHFFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Pc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
|
~%
tert-butyl-(2,4... CAS#:88765-98-4 |
| Literature: Cowley, A. H.; Pakulski, M. K. Journal of the American Chemical Society, 1984 , vol. 106, # 5 p. 1491 - 1492 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphine,(1,1-dimethylethyl)[2,4,6-tris(1,1-dimethylethyl)phenyl] |