Epigambogic acid
Modify Date: 2025-08-26 18:06:35
Epigambogic acid structure
|
Common Name | Epigambogic acid | ||
|---|---|---|---|---|
| CAS Number | 887606-04-4 | Molecular Weight | 628.75 | |
| Density | N/A | Boiling Point | 808.9±65.0 °C | |
| Molecular Formula | C38H44O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Epigambogic acidEpigambogic acid is a natural anti-tumor, antitussive, expectorant and anti-inflammatory compound[1][2]. |
| Name | Epigambogic acid |
|---|
| Description | Epigambogic acid is a natural anti-tumor, antitussive, expectorant and anti-inflammatory compound[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 808.9±65.0 °C |
|---|---|
| Molecular Formula | C38H44O8 |
| Molecular Weight | 628.75 |
| InChIKey | GEZHEQNLKAOMCA-KDFVBPPASA-N |
| SMILES | CC(C)=CCCC1(C)C=Cc2c(O)c3c(c(CC=C(C)C)c2O1)OC12C(=CC4CC1C(C)(C)OC2(CC=C(C)C(=O)O)C4=O)C3=O |