hex-1-enylselenonylbenzene
Modify Date: 2024-01-01 19:18:51
hex-1-enylselenonylbenzene structure
|
Common Name | hex-1-enylselenonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 88739-12-2 | Molecular Weight | 271.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hex-1-enylselenonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O2Se |
|---|---|
| Molecular Weight | 271.21400 |
| Exact Mass | 272.03200 |
| PSA | 34.14000 |
| LogP | 2.48240 |
| InChIKey | RVOFBDUSKWOOGN-UHFFFAOYSA-N |
| SMILES | CCCCC=C[Se](=O)(=O)c1ccccc1 |
|
~76%
hex-1-enylselen... CAS#:88739-12-2 |
| Literature: Ando, Ryoichi; Sugawara, Tomoo; Shimizu, Makoto; Kuwajima, Isao Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 10 p. 2897 - 2904 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:88739-14-4| 1-hexenyl phenyl selenone |
| Benzene,(1-hexenylselenonyl) |