Fluvoxamine Acid
Modify Date: 2025-08-31 22:15:32
Fluvoxamine Acid structure
|
Common Name | Fluvoxamine Acid | ||
|---|---|---|---|---|
| CAS Number | 88699-91-6 | Molecular Weight | 318.29200 | |
| Density | 1.29g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C14H17F3N2O3 | Melting Point | >105ºC (dec.) | |
| MSDS | N/A | Flash Point | 215.9ºC | |
Use of Fluvoxamine AcidFluvoxamine Acid is a major metabolite of Fluvoxamine. |
| Name | Fluvoxamine Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Melting Point | >105ºC (dec.) |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.29200 |
| Flash Point | 215.9ºC |
| Exact Mass | 318.11900 |
| PSA | 84.91000 |
| LogP | 3.34000 |
| Index of Refraction | 1.502 |
| InChIKey | KUIZEDQDELAFQK-XDHOZWIPSA-N |
| SMILES | NCCON=C(CCCC(=O)O)c1ccc(C(F)(F)F)cc1 |
| (E)-5-((2-aminoethoxy)imino)-5-(4-(trifluoromethyl)phenyl)pentanoic acid |