ethyl 6-(2-methylprop-2-enoxy)-1H-indole-2-carboxylate
Modify Date: 2025-09-21 13:21:08
ethyl 6-(2-methylprop-2-enoxy)-1H-indole-2-carboxylate structure
|
Common Name | ethyl 6-(2-methylprop-2-enoxy)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 88694-43-3 | Molecular Weight | 259.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 6-(2-methylprop-2-enoxy)-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO3 |
|---|---|
| Molecular Weight | 259.30000 |
| Exact Mass | 259.12100 |
| PSA | 51.32000 |
| LogP | 3.29950 |
| InChIKey | LKALFQLSBBZULH-UHFFFAOYSA-N |
| SMILES | C=C(C)COc1ccc2cc(C(=O)OCC)[nH]c2c1 |
|
~%
ethyl 6-(2-meth... CAS#:88694-43-3 |
| Literature: Moody, Christopher J. Journal of the Chemical Society, Chemical Communications, 1983 , # 20 p. 1129 - 1131 |
![4-[(2-METHYL-2-PROPEN-1-YL)OXY]BENZALDEHYDE structure](https://image.chemsrc.com/caspic/019/38002-91-4.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| ethyl 6-(2-methylallyloxy)indole-2-carboxylate |
| 1H-Indole-2-carboxylic acid,6-[(2-methyl-2-propenyl)oxy]-,ethyl ester |