N-(3,5-dichloro-4-nitrophenyl)benzenesulfonamide structure
|
Common Name | N-(3,5-dichloro-4-nitrophenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 88681-05-4 | Molecular Weight | 347.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl2N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3,5-dichloro-4-nitrophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8Cl2N2O4S |
|---|---|
| Molecular Weight | 347.17400 |
| Exact Mass | 345.95800 |
| PSA | 100.37000 |
| LogP | 5.37940 |
| InChIKey | TXNCGDZIICLOLC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)cc(NS(=O)(=O)c2ccccc2)cc1Cl |
|
~%
N-(3,5-dichloro... CAS#:88681-05-4 |
| Literature: Adams et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 1114,1117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonamide,N-(3,5-dichloro-4-nitrophenyl) |
| benzenesulfonic acid-(3,5-dichloro-4-nitro-anilide) |
| Benzolsulfonsaeure-(3,5-dichlor-4-nitro-anilid) |